Statistics for Phosphinoorganosilane synthesis and Bis(phosphinoorgano)silyl complexes of ruthenium
Total visits
| views | |
|---|---|
| Phosphinoorganosilane synthesis and Bis(phosphinoorgano)silyl complexes of ruthenium | 4 |
Total visits per month
| views | |
|---|---|
| January 2026 | 0 |
| February 2026 | 0 |
| March 2026 | 0 |
| April 2026 | 0 |
| May 2026 | 1 |
| June 2026 | 0 |
| July 2026 | 0 |
File Visits
| views | |
|---|---|
| Zhou_Xiaobing_PhD_1998.pdf | 240 |
Top country views
| views | |
|---|---|
| Canada | 1 |
| China | 1 |
| India | 1 |
| Sweden | 1 |
Top city views
| views | |
|---|---|
| Kitimat | 1 |
| New Delhi (Harkesh Nagar) | 1 |
| Shanghai | 1 |
| Stockholm | 1 |