Statistics for Phosphinoorganosilane synthesis and Bis(phosphinoorgano)silyl complexes of ruthenium
Total visits
| views | |
|---|---|
| Phosphinoorganosilane synthesis and Bis(phosphinoorgano)silyl complexes of ruthenium | 3 |
Total visits per month
| views | |
|---|---|
| October 2025 | 0 |
| November 2025 | 0 |
| December 2025 | 0 |
| January 2026 | 0 |
| February 2026 | 0 |
| March 2026 | 0 |
| April 2026 | 0 |
File Visits
| views | |
|---|---|
| Zhou_Xiaobing_PhD_1998.pdf | 181 |
Top country views
| views | |
|---|---|
| Canada | 1 |
| India | 1 |
| Sweden | 1 |
Top city views
| views | |
|---|---|
| Kitimat | 1 |
| New Delhi (Harkesh Nagar) | 1 |
| Stockholm | 1 |